상품명칭 |
2-Diethylaminoethanethiol hydrochloride |
별명 |
diethyl-2-mercaptoethylammonium chloride; 2-Diethylaminoethanthiol Hydrochloride; 2-(diethylamino)ethanethiol hydrochloride (1:1); N,N-diethyl-2-sulfanylethanaminium |
분자식 |
C6H16NS |
분자량 |
134.2624 |
InChI |
InChI=1/C6H15NS/c1-3-7(4-2)5-6-8/h8H,3-6H2,1-2H3/p+1 |
cas번호 |
1942-52-5 |
EC번호 |
217-731-8 |
분자 구조 |
|
녹는 점 |
168-175℃ |
비등점 |
161.6°C at 760 mmHg |
인화점 |
51.5°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|