Nazwa produktu: |
2-Diethylaminoethanethiol hydrochloride |
Synonimy |
diethyl-2-mercaptoethylammonium chloride; 2-Diethylaminoethanthiol Hydrochloride; 2-(diethylamino)ethanethiol hydrochloride (1:1); N,N-diethyl-2-sulfanylethanaminium |
MF |
C6H16NS |
Masie cząsteczkowej |
134.2624 |
InChI |
InChI=1/C6H15NS/c1-3-7(4-2)5-6-8/h8H,3-6H2,1-2H3/p+1 |
Nr CAS |
1942-52-5 |
EINECS |
217-731-8 |
Struktury molekularnej |
|
Temperatura topnienia |
168-175℃ |
Temperatura wrzenia |
161.6°C at 760 mmHg |
Temperatura zapłonu |
51.5°C |
Symbole zagrożenia |
Xi:Irritant;
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|