Название продукта |
2-Diethylaminoethanethiol hydrochloride |
Синонимы |
diethyl-2-mercaptoethylammonium chloride; 2-Diethylaminoethanthiol Hydrochloride; 2-(diethylamino)ethanethiol hydrochloride (1:1); N,N-diethyl-2-sulfanylethanaminium |
Молекулярная формула |
C6H16NS |
Молекулярный вес |
134.2624 |
InChI |
InChI=1/C6H15NS/c1-3-7(4-2)5-6-8/h8H,3-6H2,1-2H3/p+1 |
Регистрационный номер CAS |
1942-52-5 |
EINECS |
217-731-8 |
Молекулярная структура |
|
Температура плавления |
168-175℃ |
Точка кипения |
161.6°C at 760 mmHg |
Температура вспышки |
51.5°C |
Символы опасности |
Xi:Irritant;
|
Риск коды |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Характеристики безопасности |
S24/25:Avoid contact with skin and eyes.;
|