상품명칭 |
2-Bromo-4,5-dimethoxycinnamic acid |
별명 |
(2E)-3-(2-bromo-4,5-dimethoxyphenyl)prop-2-enoate |
분자식 |
C11H10BrO4 |
분자량 |
286.0992 |
InChI |
InChI=1/C11H11BrO4/c1-15-9-5-7(3-4-11(13)14)8(12)6-10(9)16-2/h3-6H,1-2H3,(H,13,14)/p-1/b4-3+ |
cas번호 |
195383-80-3 |
분자 구조 |
|
녹는 점 |
253-254℃ |
비등점 |
409.5°C at 760 mmHg |
인화점 |
201.4°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|