Ürün Adı |
2-Bromo-4,5-dimethoxycinnamic acid |
Eş anlamlı |
(2E)-3-(2-bromo-4,5-dimethoxyphenyl)prop-2-enoate |
Moleküler Formülü |
C11H10BrO4 |
Molekül Ağırlığı |
286.0992 |
InChI |
InChI=1/C11H11BrO4/c1-15-9-5-7(3-4-11(13)14)8(12)6-10(9)16-2/h3-6H,1-2H3,(H,13,14)/p-1/b4-3+ |
CAS kayıt numarası |
195383-80-3 |
Moleküler Yapısı |
|
Ergime noktası |
253-254℃ |
Kaynama noktası |
409.5°C at 760 mmHg |
Alevlenme noktası |
201.4°C |
Tehlike Sembolleri |
Xi:Irritant;
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|