Nama produk |
2-Bromo-4,5-dimethoxycinnamic acid |
Sinonim |
(2E)-3-(2-bromo-4,5-dimethoxyphenyl)prop-2-enoate |
MF |
C11H10BrO4 |
Berat Molekul |
286.0992 |
InChI |
InChI=1/C11H11BrO4/c1-15-9-5-7(3-4-11(13)14)8(12)6-10(9)16-2/h3-6H,1-2H3,(H,13,14)/p-1/b4-3+ |
CAS NO |
195383-80-3 |
Struktur Molekul |
|
Titik lebur |
253-254℃ |
Titik didih |
409.5°C at 760 mmHg |
Titik nyala |
201.4°C |
Cinta bahaya |
Xi:Irritant;
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|