نام محصول |
2-Pyrazinecarbonyl chloride |
مترادف |
Pyrazinecarbonyl chloride; Pyrazine-2-carbonyl chloride |
میدان مغناطیسی |
C5H3ClN2O |
وزن مولکولی |
142.5431 |
InChI |
InChI=1/C5H3ClN2O/c6-5(9)4-3-7-1-2-8-4/h1-3H |
شماره سیایاس |
19847-10-0 |
تعداد کمیسیون اروپایی |
243-367-4 |
ساختار مولکولی |
|
تراکم |
1.393g/cm3 |
نقطه ذوب |
40.9℃ |
نقطه غلیان |
214.5°C at 760 mmHg |
ضریب شکست |
1.551 |
نقطه اشتعال |
83.5°C |
خطر نمادها |
C:Corrosive;
|
کدهای خطر |
R34:Causes burns.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|