상품명칭 |
2-Pyrazinecarbonyl chloride |
별명 |
Pyrazinecarbonyl chloride; Pyrazine-2-carbonyl chloride |
분자식 |
C5H3ClN2O |
분자량 |
142.5431 |
InChI |
InChI=1/C5H3ClN2O/c6-5(9)4-3-7-1-2-8-4/h1-3H |
cas번호 |
19847-10-0 |
EC번호 |
243-367-4 |
분자 구조 |
|
밀도 |
1.393g/cm3 |
녹는 점 |
40.9℃ |
비등점 |
214.5°C at 760 mmHg |
굴절 지수 |
1.551 |
인화점 |
83.5°C |
위험성 표시 |
C:Corrosive;
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|