Ürün Adı |
2-Pyrazinecarbonyl chloride |
Eş anlamlı |
Pyrazinecarbonyl chloride; Pyrazine-2-carbonyl chloride |
Moleküler Formülü |
C5H3ClN2O |
Molekül Ağırlığı |
142.5431 |
InChI |
InChI=1/C5H3ClN2O/c6-5(9)4-3-7-1-2-8-4/h1-3H |
CAS kayıt numarası |
19847-10-0 |
EINECS |
243-367-4 |
Moleküler Yapısı |
|
Yoğunluk |
1.393g/cm3 |
Ergime noktası |
40.9℃ |
Kaynama noktası |
214.5°C at 760 mmHg |
Kırılma indisi |
1.551 |
Alevlenme noktası |
83.5°C |
Tehlike Sembolleri |
C:Corrosive;
|
Risk Kodları |
R34:Causes burns.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|