product Name |
2-Bromo-4-fluoro-1-iodobenzene |
Synonyms |
2-Bromo-4-fluoroiodobenzene |
Molecular Formula |
C6H3BrFI |
Molecular Weight |
300.8949 |
InChI |
InChI=1/C6H3BrFI/c7-5-3-4(8)1-2-6(5)9/h1-3H |
CAS Registry Number |
202865-73-4 |
Molecular Structure |
|
Density |
2.281g/cm3 |
Boiling point |
243.2°C at 760 mmHg |
Refractive index |
1.628 |
Flash point |
100.9°C |
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|