상품명칭 |
2-Bromo-4-fluoro-1-iodobenzene |
별명 |
2-Bromo-4-fluoroiodobenzene |
분자식 |
C6H3BrFI |
분자량 |
300.8949 |
InChI |
InChI=1/C6H3BrFI/c7-5-3-4(8)1-2-6(5)9/h1-3H |
cas번호 |
202865-73-4 |
분자 구조 |
|
밀도 |
2.281g/cm3 |
비등점 |
243.2°C at 760 mmHg |
굴절 지수 |
1.628 |
인화점 |
100.9°C |
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|