Nama produk |
2-Bromo-4-fluoro-1-iodobenzene |
Sinonim |
2-Bromo-4-fluoroiodobenzene |
MF |
C6H3BrFI |
Berat Molekul |
300.8949 |
InChI |
InChI=1/C6H3BrFI/c7-5-3-4(8)1-2-6(5)9/h1-3H |
CAS NO |
202865-73-4 |
Struktur Molekul |
|
Kepadatan |
2.281g/cm3 |
Titik didih |
243.2°C at 760 mmHg |
Indeks bias |
1.628 |
Titik nyala |
100.9°C |
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|