상품명칭 |
2-Iodo-3-methylpyridine |
별명 |
2-Iodo-3-picoline |
분자식 |
C6H6IN |
분자량 |
219.023 |
InChI |
InChI=1/C6H6IN/c1-5-3-2-4-8-6(5)7/h2-4H,1H3 |
cas번호 |
22282-58-2 |
분자 구조 |
|
밀도 |
1.81g/cm3 |
비등점 |
237.412°C at 760 mmHg |
굴절 지수 |
1.612 |
인화점 |
97.384°C |
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|