Nama produk |
2-Iodo-3-methylpyridine |
Sinonim |
2-Iodo-3-picoline |
MF |
C6H6IN |
Berat Molekul |
219.023 |
InChI |
InChI=1/C6H6IN/c1-5-3-2-4-8-6(5)7/h2-4H,1H3 |
CAS NO |
22282-58-2 |
Struktur Molekul |
|
Kepadatan |
1.81g/cm3 |
Titik didih |
237.412°C at 760 mmHg |
Indeks bias |
1.612 |
Titik nyala |
97.384°C |
Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|