Naam product |
2-Iodo-3-methylpyridine |
Synoniemen |
2-Iodo-3-picoline |
MF |
C6H6IN |
Molecuulgewicht |
219.023 |
InChI |
InChI=1/C6H6IN/c1-5-3-2-4-8-6(5)7/h2-4H,1H3 |
CAS-nummer |
22282-58-2 |
Moleculaire Structuur |
|
Dichtheid |
1.81g/cm3 |
Kookpunt |
237.412°C at 760 mmHg |
Brekingsindex |
1.612 |
Vlampunt |
97.384°C |
Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|