termék neve |
ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate |
Szinonimák |
3-Acetyl-2,4-dimethyl-5-carbethoxypyrrole; 4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl propanoate |
MF |
C11H15NO3 |
Molekulatömeg |
209.2417 |
InChI |
InChI=1/C11H15NO3/c1-5-9(14)15-11-6(2)10(8(4)13)7(3)12-11/h12H,5H2,1-4H3 |
CAS-szám |
2386-26-7 |
Molekuláris szerkezete |
|
Sűrűség |
1.125g/cm3 |
Olvadáspont |
139℃ |
Forráspont |
348.9°C at 760 mmHg |
Törésmutató |
1.517 |
Gyulladáspont |
164.8°C |
Veszély szimbólumok |
Xi:Irritant;
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|