produktnavn |
ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate |
Synonymer |
3-Acetyl-2,4-dimethyl-5-carbethoxypyrrole; 4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl propanoate |
Molekylær Formel |
C11H15NO3 |
Molekylvekt |
209.2417 |
InChI |
InChI=1/C11H15NO3/c1-5-9(14)15-11-6(2)10(8(4)13)7(3)12-11/h12H,5H2,1-4H3 |
CAS-nummer |
2386-26-7 |
Molecular Structure |
|
Tetthet |
1.125g/cm3 |
Smeltepunkt |
139℃ |
Kokepunkt |
348.9°C at 760 mmHg |
Brytningsindeks |
1.517 |
Flammepunktet |
164.8°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|