Naam product |
ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate |
Synoniemen |
3-Acetyl-2,4-dimethyl-5-carbethoxypyrrole; 4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl propanoate |
MF |
C11H15NO3 |
Molecuulgewicht |
209.2417 |
InChI |
InChI=1/C11H15NO3/c1-5-9(14)15-11-6(2)10(8(4)13)7(3)12-11/h12H,5H2,1-4H3 |
CAS-nummer |
2386-26-7 |
Moleculaire Structuur |
|
Dichtheid |
1.125g/cm3 |
Smeltpunt |
139℃ |
Kookpunt |
348.9°C at 760 mmHg |
Brekingsindex |
1.517 |
Vlampunt |
164.8°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|