نام Ù…Øصول |
2-Chloro-3,6-difluorobenzoic acid |
میدان مغناطیسی |
C7H3ClF2O2 |
وزن مولکولی |
192.5473 |
InChI |
InChI=1/C7H3ClF2O2/c8-6-4(10)2-1-3(9)5(6)7(11)12/h1-2H,(H,11,12) |
شماره سیایاس |
287172-74-1 |
ساختار مولکولی |
|
تراکم |
1.573g/cm3 |
نقطه غلیان |
266.6°C at 760 mmHg |
ضریب شکست |
1.534 |
نقطه اشتعال |
115°C |
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیØات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|