produktnavn |
2-Chloro-3,6-difluorobenzoic acid |
Molekylær Formel |
C7H3ClF2O2 |
Molekylvekt |
192.5473 |
InChI |
InChI=1/C7H3ClF2O2/c8-6-4(10)2-1-3(9)5(6)7(11)12/h1-2H,(H,11,12) |
CAS-nummer |
287172-74-1 |
Molecular Structure |
|
Tetthet |
1.573g/cm3 |
Kokepunkt |
266.6°C at 760 mmHg |
Brytningsindeks |
1.534 |
Flammepunktet |
115°C |
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|