Nama produk |
2-Chloro-3,6-difluorobenzoic acid |
MF |
C7H3ClF2O2 |
Berat Molekul |
192.5473 |
InChI |
InChI=1/C7H3ClF2O2/c8-6-4(10)2-1-3(9)5(6)7(11)12/h1-2H,(H,11,12) |
CAS NO |
287172-74-1 |
Struktur Molekul |
|
Kepadatan |
1.573g/cm3 |
Titik didih |
266.6°C at 760 mmHg |
Indeks bias |
1.534 |
Titik nyala |
115°C |
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|