DL-2-Chloro-2-phenylacetyl chloride

Ονομασία του προϊόντος	DL-2-Chloro-2-phenylacetyl chloride
Συνώνυμα	Chloro(phenyl)acetyl chloride; CCRIS 8624; (2S)-chloro(phenyl)ethanoyl chloride; (2R)-chloro(phenyl)ethanoyl chloride
MF	C₈H₆Cl₂O
Μοριακό βάρος	189.0386
InChI	InChI=1/C8H6Cl2O/c9-7(8(10)11)6-4-2-1-3-5-6/h1-5,7H/t7-/m1/s1
CAS ΟΧΙ	2912-62-1
EINECS	220-826-7
Μοριακή δομή
Πυκνότητα	1.322g/cm³
Σημείο βρασμού	228°C at 760 mmHg
Δείκτης διάθλασης	1.55
Σημείο ανάφλεξης	104.4°C
Σύμβολα επικινδυνότητας	C:Corrosive;
Κινδύνου Κώδικες	R34:Causes burns.; R36/37:Irritating to eyes and respiratory system.;
Περιγραφή της ασφάλειας	S25:Avoid contact with eyes.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;