उत्पाद का नाम |
DL-2-Chloro-2-phenylacetyl chloride |
समानार्थी |
Chloro(phenyl)acetyl chloride; CCRIS 8624; (2S)-chloro(phenyl)ethanoyl chloride; (2R)-chloro(phenyl)ethanoyl chloride |
आणविक फार्मूला |
C8H6Cl2O |
आण्विक वजन |
189.0386 |
InChI |
InChI=1/C8H6Cl2O/c9-7(8(10)11)6-4-2-1-3-5-6/h1-5,7H/t7-/m1/s1 |
कैस रजिस्टी संख्या |
2912-62-1 |
EINECS |
220-826-7 |
आणविक संरचना |
|
घनत्व |
1.322g/cm3 |
उबलने का समय |
228°C at 760 mmHg |
अपवर्तक सूचकांक |
1.55 |
फ्लैश प्वाइंट |
104.4°C |
खतरा प्रतीक |
C:Corrosive;
|
खतरे के कोड |
R34:Causes burns.;
R36/37:Irritating to eyes and respiratory system.;
|
सुरक्षा विवरण |
S25:Avoid contact with eyes.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|