DL-2-Chloro-2-phenylacetyl chloride

उत्पाद का नाम	DL-2-Chloro-2-phenylacetyl chloride
समानार्थी	Chloro(phenyl)acetyl chloride; CCRIS 8624; (2S)-chloro(phenyl)ethanoyl chloride; (2R)-chloro(phenyl)ethanoyl chloride
आणविक फार्मूला	C₈H₆Cl₂O
आण्विक वजन	189.0386
InChI	InChI=1/C8H6Cl2O/c9-7(8(10)11)6-4-2-1-3-5-6/h1-5,7H/t7-/m1/s1
कैस रजिस्टी संख्या	2912-62-1
EINECS	220-826-7
आणविक संरचना
घनत्व	1.322g/cm³
उबलने का समय	228°C at 760 mmHg
अपवर्तक सूचकांक	1.55
फ्लैश प्वाइंट	104.4°C
खतरा प्रतीक	C:Corrosive;
खतरे के कोड	R34:Causes burns.; R36/37:Irritating to eyes and respiratory system.;
सुरक्षा विवरण	S25:Avoid contact with eyes.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;