Ürün Adı |
DL-2-Chloro-2-phenylacetyl chloride |
Eş anlamlı |
Chloro(phenyl)acetyl chloride; CCRIS 8624; (2S)-chloro(phenyl)ethanoyl chloride; (2R)-chloro(phenyl)ethanoyl chloride |
Moleküler Formülü |
C8H6Cl2O |
Molekül Ağırlığı |
189.0386 |
InChI |
InChI=1/C8H6Cl2O/c9-7(8(10)11)6-4-2-1-3-5-6/h1-5,7H/t7-/m1/s1 |
CAS kayıt numarası |
2912-62-1 |
EINECS |
220-826-7 |
Moleküler Yapısı |
|
Yoğunluk |
1.322g/cm3 |
Kaynama noktası |
228°C at 760 mmHg |
Kırılma indisi |
1.55 |
Alevlenme noktası |
104.4°C |
Tehlike Sembolleri |
C:Corrosive;
|
Risk Kodları |
R34:Causes burns.;
R36/37:Irritating to eyes and respiratory system.;
|
Güvenlik Açıklaması |
S25:Avoid contact with eyes.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|