نام محصول |
4-chlorofuro[3,2-c]pyridine |
میدان مغناطیسی |
C7H4ClNO |
وزن مولکولی |
153.5658 |
InChI |
InChI=1/C7H4ClNO/c8-7-5-2-4-10-6(5)1-3-9-7/h1-4H |
شماره سیایاس |
31270-80-1 |
ساختار مولکولی |
|
تراکم |
1.377g/cm3 |
نقطه ذوب |
40℃ |
نقطه غلیان |
242.806°C at 760 mmHg |
ضریب شکست |
1.624 |
نقطه اشتعال |
100.646°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|