Nama produk |
4-chlorofuro[3,2-c]pyridine |
MF |
C7H4ClNO |
Berat Molekul |
153.5658 |
InChI |
InChI=1/C7H4ClNO/c8-7-5-2-4-10-6(5)1-3-9-7/h1-4H |
CAS NO |
31270-80-1 |
Struktur Molekul |
|
Kepadatan |
1.377g/cm3 |
Titik lebur |
40℃ |
Titik didih |
242.806°C at 760 mmHg |
Indeks bias |
1.624 |
Titik nyala |
100.646°C |
Cinta bahaya |
Xi:Irritant;
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|