Nazwa produktu: |
4-chlorofuro[3,2-c]pyridine |
MF |
C7H4ClNO |
Masie cząsteczkowej |
153.5658 |
InChI |
InChI=1/C7H4ClNO/c8-7-5-2-4-10-6(5)1-3-9-7/h1-4H |
Nr CAS |
31270-80-1 |
Struktury molekularnej |
|
Gęstość |
1.377g/cm3 |
Temperatura topnienia |
40℃ |
Temperatura wrzenia |
242.806°C at 760 mmHg |
Współczynnik załamania |
1.624 |
Temperatura zapłonu |
100.646°C |
Symbole zagrożenia |
Xi:Irritant;
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|