termék neve |
(4-fluorophenylthio)acetic acid |
Szinonimák |
2-[(4-Fluorophenyl)thio]acetic acid; [(4-fluorophenyl)sulfanyl]acetic acid; [(4-fluorophenyl)sulfanyl]acetate; 2-(4-Fluorophenylthio)acetic acid |
MF |
C8H6FO2S |
Molekulatömeg |
185.196 |
InChI |
InChI=1/C8H7FO2S/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5H2,(H,10,11)/p-1 |
CAS-szám |
332-51-4 |
Molekuláris szerkezete |
|
Olvadáspont |
76-79℃ |
Forráspont |
315.4°C at 760 mmHg |
Gyulladáspont |
144.5°C |
Veszély szimbólumok |
Xi:Irritant;
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|