اسم المنتج |
(4-fluorophenylthio)acetic acid |
الاسم المستعار |
2-[(4-Fluorophenyl)thio]acetic acid; [(4-fluorophenyl)sulfanyl]acetic acid; [(4-fluorophenyl)sulfanyl]acetate; 2-(4-Fluorophenylthio)acetic acid |
الصيغة الجزيئية |
C8H6FO2S |
الوزن الجزيئي الغرامي |
185.196 |
InChI |
InChI=1/C8H7FO2S/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5H2,(H,10,11)/p-1 |
إستراتيجية المساعدة القطرية |
332-51-4 |
بنية جزيئية |
|
درجة الإنصهار |
76-79℃ |
نقطة الغليان |
315.4°C at 760 mmHg |
نقطة الوميض |
144.5°C |
علامات على البضائع الخطرة |
Xi:Irritant;
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|