상품명칭 |
(4-fluorophenylthio)acetic acid |
별명 |
2-[(4-Fluorophenyl)thio]acetic acid; [(4-fluorophenyl)sulfanyl]acetic acid; [(4-fluorophenyl)sulfanyl]acetate; 2-(4-Fluorophenylthio)acetic acid |
분자식 |
C8H6FO2S |
분자량 |
185.196 |
InChI |
InChI=1/C8H7FO2S/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5H2,(H,10,11)/p-1 |
cas번호 |
332-51-4 |
분자 구조 |
|
녹는 점 |
76-79℃ |
비등점 |
315.4°C at 760 mmHg |
인화점 |
144.5°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|