Produkt-Name |
5-phenyl-1,3-oxazole-4-carbonyl chloride |
Synonyme |
5-phenyloxazole-4-carbonyl chloride |
Molekulare Formel |
C10H6ClNO2 |
Molecular Weight |
207.6131 |
InChI |
InChI=1/C10H6ClNO2/c11-10(13)8-9(14-6-12-8)7-4-2-1-3-5-7/h1-6H |
CAS Registry Number |
337508-64-2 |
Molecular Structure |
|
Dichte |
1.321g/cm3 |
Schmelzpunkt |
68℃ |
Siedepunkt |
357.187°C at 760 mmHg |
Brechungsindex |
1.569 |
Flammpunkt |
169.821°C |
Gefahrensymbole |
C:Corrosive;
|
Risk Codes |
R34:Causes burns.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|