5-phenyl-1,3-oxazole-4-carbonyl chloride

Ονομασία του προϊόντος	5-phenyl-1,3-oxazole-4-carbonyl chloride
Συνώνυμα	5-phenyloxazole-4-carbonyl chloride
MF	C₁₀H₆ClNO₂
Μοριακό βάρος	207.6131
InChI	InChI=1/C10H6ClNO2/c11-10(13)8-9(14-6-12-8)7-4-2-1-3-5-7/h1-6H
CAS ΟΧΙ	337508-64-2
Μοριακή δομή
Πυκνότητα	1.321g/cm³
Σημείο τήξης	68℃
Σημείο βρασμού	357.187°C at 760 mmHg
Δείκτης διάθλασης	1.569
Σημείο ανάφλεξης	169.821°C
Σύμβολα επικινδυνότητας	C:Corrosive;
Κινδύνου Κώδικες	R34:Causes burns.;
Περιγραφή της ασφάλειας	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;