5-phenyl-1,3-oxazole-4-carbonyl chloride

نام محصول	5-phenyl-1,3-oxazole-4-carbonyl chloride
مترادف	5-phenyloxazole-4-carbonyl chloride
میدان مغناطیسی	C₁₀H₆ClNO₂
وزن مولکولی	207.6131
InChI	InChI=1/C10H6ClNO2/c11-10(13)8-9(14-6-12-8)7-4-2-1-3-5-7/h1-6H
شماره سیایاس	337508-64-2
ساختار مولکولی
تراکم	1.321g/cm³
نقطه ذوب	68℃
نقطه غلیان	357.187°C at 760 mmHg
ضریب شکست	1.569
نقطه اشتعال	169.821°C
خطر نمادها	C:Corrosive;
کدهای خطر	R34:Causes burns.;
توضیحات ایمنی	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;