Nome del prodotto |
Acetoxybenzaldehyde; 97% |
Sinonimi |
3-Acetoxybenzaldehyde; 3-Formylphenyl acetate |
Formula molecolare |
C9H8O3 |
Peso Molecolare |
164.158 |
InChI |
InChI=1/C9H8O3/c1-7(11)12-9-4-2-3-8(5-9)6-10/h2-6H,1H3 |
Numero CAS |
34231-78-2 |
EINECS |
251-890-4 |
Struttura molecolare |
|
Densità |
1.183g/cm3 |
Punto di ebollizione |
271.6°C at 760 mmHg |
Indice di rifrazione |
1.552 |
Punto d'infiammabilità |
117.6°C |
Codici di Rischio |
R36/38:Irritating to eyes and skin.;
|
Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|