상품명칭 |
Acetoxybenzaldehyde; 97% |
별명 |
3-Acetoxybenzaldehyde; 3-Formylphenyl acetate |
분자식 |
C9H8O3 |
분자량 |
164.158 |
InChI |
InChI=1/C9H8O3/c1-7(11)12-9-4-2-3-8(5-9)6-10/h2-6H,1H3 |
cas번호 |
34231-78-2 |
EC번호 |
251-890-4 |
분자 구조 |
|
밀도 |
1.183g/cm3 |
비등점 |
271.6°C at 760 mmHg |
굴절 지수 |
1.552 |
인화점 |
117.6°C |
리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|