produktnavn |
Acetoxybenzaldehyde; 97% |
Synonymer |
3-Acetoxybenzaldehyde; 3-Formylphenyl acetate |
Molekylær Formel |
C9H8O3 |
Molekylvekt |
164.158 |
InChI |
InChI=1/C9H8O3/c1-7(11)12-9-4-2-3-8(5-9)6-10/h2-6H,1H3 |
CAS-nummer |
34231-78-2 |
EINECS |
251-890-4 |
Molecular Structure |
|
Tetthet |
1.183g/cm3 |
Kokepunkt |
271.6°C at 760 mmHg |
Brytningsindeks |
1.552 |
Flammepunktet |
117.6°C |
Risiko Koder |
R36/38:Irritating to eyes and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|