Produkt-Name |
Butyric acid hydrazide |
Synonyme |
Butyrohydrazide; Butyrylhydrazine; butanehydrazide |
Molekulare Formel |
C4H10N2O |
Molecular Weight |
102.135 |
InChI |
InChI=1/C4H10N2O/c1-2-3-4(7)6-5/h2-3,5H2,1H3,(H,6,7) |
CAS Registry Number |
3538-65-6 |
EINECS |
222-579-0 |
Molecular Structure |
|
Dichte |
0.98g/cm3 |
Siedepunkt |
249.8°C at 760 mmHg |
Brechungsindex |
1.445 |
Flammpunkt |
104.9°C |
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|