نام محصول |
Butyric acid hydrazide |
مترادف |
Butyrohydrazide; Butyrylhydrazine; butanehydrazide |
میدان مغناطیسی |
C4H10N2O |
وزن مولکولی |
102.135 |
InChI |
InChI=1/C4H10N2O/c1-2-3-4(7)6-5/h2-3,5H2,1H3,(H,6,7) |
شماره سیایاس |
3538-65-6 |
تعداد کمیسیون اروپایی |
222-579-0 |
ساختار مولکولی |
|
تراکم |
0.98g/cm3 |
نقطه غلیان |
249.8°C at 760 mmHg |
ضریب شکست |
1.445 |
نقطه اشتعال |
104.9°C |
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|