product Name |
Butyric acid hydrazide |
Synonyms |
Butyrohydrazide; Butyrylhydrazine; butanehydrazide |
Molecular Formula |
C4H10N2O |
Molecular Weight |
102.135 |
InChI |
InChI=1/C4H10N2O/c1-2-3-4(7)6-5/h2-3,5H2,1H3,(H,6,7) |
CAS Registry Number |
3538-65-6 |
EINECS |
222-579-0 |
Molecular Structure |
|
Density |
0.98g/cm3 |
Boiling point |
249.8°C at 760 mmHg |
Refractive index |
1.445 |
Flash point |
104.9°C |
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|