نام محصول |
Valeric acid hydrazide |
مترادف |
Pentanoic acid hydrazide; pentanehydrazide |
میدان مغناطیسی |
C5H12N2O |
وزن مولکولی |
116.1616 |
InChI |
InChI=1/C5H12N2O/c1-2-3-4-5(8)7-6/h2-4,6H2,1H3,(H,7,8) |
شماره سیایاس |
38291-82-6 |
تعداد کمیسیون اروپایی |
253-864-8 |
ساختار مولکولی |
|
تراکم |
0.962g/cm3 |
نقطه غلیان |
260.6°C at 760 mmHg |
ضریب شکست |
1.449 |
نقطه اشتعال |
111.4°C |
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|