Nama produk |
Valeric acid hydrazide |
Sinonim |
Pentanoic acid hydrazide; pentanehydrazide |
MF |
C5H12N2O |
Berat Molekul |
116.1616 |
InChI |
InChI=1/C5H12N2O/c1-2-3-4-5(8)7-6/h2-4,6H2,1H3,(H,7,8) |
CAS NO |
38291-82-6 |
EINECS |
253-864-8 |
Struktur Molekul |
|
Kepadatan |
0.962g/cm3 |
Titik didih |
260.6°C at 760 mmHg |
Indeks bias |
1.449 |
Titik nyala |
111.4°C |
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|