اسم المنتج |
Valeric acid hydrazide |
الاسم المستعار |
Pentanoic acid hydrazide; pentanehydrazide |
الصيغة الجزيئية |
C5H12N2O |
الوزن الجزيئي الغرامي |
116.1616 |
InChI |
InChI=1/C5H12N2O/c1-2-3-4-5(8)7-6/h2-4,6H2,1H3,(H,7,8) |
إستراتيجية المساعدة القطرية |
38291-82-6 |
المفوضية الأوروبية رقم |
253-864-8 |
بنية جزيئية |
|
كثافة |
0.962g/cm3 |
نقطة الغليان |
260.6°C at 760 mmHg |
معامل الإنكسار |
1.449 |
نقطة الوميض |
111.4°C |
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|