product Name |
4-Chloro-3-nitrocoumarin |
Synonyms |
4-chloro-3-nitro-2H-chromen-2-one |
Molecular Formula |
C9H4ClNO4 |
Molecular Weight |
225.5854 |
InChI |
InChI=1/C9H4ClNO4/c10-7-5-3-1-2-4-6(5)15-9(12)8(7)11(13)14/h1-4H |
CAS Registry Number |
38464-20-9 |
Molecular Structure |
|
Density |
1.6g/cm3 |
Melting point |
160-164℃ |
Boiling point |
338.7°C at 760 mmHg |
Refractive index |
1.642 |
Flash point |
158.6°C |
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|