Naam product |
4-Chloro-3-nitrocoumarin |
Synoniemen |
4-chloro-3-nitro-2H-chromen-2-one |
MF |
C9H4ClNO4 |
Molecuulgewicht |
225.5854 |
InChI |
InChI=1/C9H4ClNO4/c10-7-5-3-1-2-4-6(5)15-9(12)8(7)11(13)14/h1-4H |
CAS-nummer |
38464-20-9 |
Moleculaire Structuur |
|
Dichtheid |
1.6g/cm3 |
Smeltpunt |
160-164℃ |
Kookpunt |
338.7°C at 760 mmHg |
Brekingsindex |
1.642 |
Vlampunt |
158.6°C |
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|