상품명칭 |
4-Chloro-3-nitrocoumarin |
별명 |
4-chloro-3-nitro-2H-chromen-2-one |
분자식 |
C9H4ClNO4 |
분자량 |
225.5854 |
InChI |
InChI=1/C9H4ClNO4/c10-7-5-3-1-2-4-6(5)15-9(12)8(7)11(13)14/h1-4H |
cas번호 |
38464-20-9 |
분자 구조 |
|
밀도 |
1.6g/cm3 |
녹는 점 |
160-164℃ |
비등점 |
338.7°C at 760 mmHg |
굴절 지수 |
1.642 |
인화점 |
158.6°C |
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|