Ονομασία του προϊόντος |
methyl 2-fluorobenzoate |
Συνώνυμα |
2-Fluorobenzoic acid methyl ester |
MF |
C8H7FO2 |
Μοριακό βάρος |
154.14 |
InChI |
InChI=1/C8H7FO2/c1-11-8(10)6-4-2-3-5-7(6)9/h2-5H,1H3 |
CAS ΟΧΙ |
394-35-4 |
EINECS |
206-894-0 |
Μοριακή δομή |
|
Πυκνότητα |
1.21 |
Σημείο βρασμού |
99℃ (18 torr) |
Κινδύνου Κώδικες |
R36/38:Irritating to eyes and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|