نام محصول |
methyl 2-fluorobenzoate |
مترادف |
2-Fluorobenzoic acid methyl ester |
میدان مغناطیسی |
C8H7FO2 |
وزن مولکولی |
154.14 |
InChI |
InChI=1/C8H7FO2/c1-11-8(10)6-4-2-3-5-7(6)9/h2-5H,1H3 |
شماره سیایاس |
394-35-4 |
تعداد کمیسیون اروپایی |
206-894-0 |
ساختار مولکولی |
|
تراکم |
1.21 |
نقطه غلیان |
99℃ (18 torr) |
کدهای خطر |
R36/38:Irritating to eyes and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|