اسم المنتج |
methyl 2-fluorobenzoate |
الاسم المستعار |
2-Fluorobenzoic acid methyl ester |
الصيغة الجزيئية |
C8H7FO2 |
الوزن الجزيئي الغرامي |
154.14 |
InChI |
InChI=1/C8H7FO2/c1-11-8(10)6-4-2-3-5-7(6)9/h2-5H,1H3 |
إستراتيجية المساعدة القطرية |
394-35-4 |
المفوضية الأوروبية رقم |
206-894-0 |
بنية جزيئية |
|
كثافة |
1.21 |
نقطة الغليان |
99℃ (18 torr) |
خطر المصطلحات |
R36/38:Irritating to eyes and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|