product Name |
7-Phenylheptanoic acid |
Molecular Formula |
C13H18O2 |
Molecular Weight |
206.2808 |
InChI |
InChI=1/C13H18O2/c14-13(15)11-7-2-1-4-8-12-9-5-3-6-10-12/h3,5-6,9-10H,1-2,4,7-8,11H2,(H,14,15) |
CAS Registry Number |
40228-90-8 |
Molecular Structure |
|
Density |
1.034g/cm3 |
Boiling point |
356.5°C at 760 mmHg |
Refractive index |
1.519 |
Flash point |
253.5°C |
Risk Codes |
R36/38:Irritating to eyes and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|