7-Phenylheptanoic acid

उत्पाद का नाम	7-Phenylheptanoic acid
आणविक फार्मूला	C₁₃H₁₈O₂
आण्विक वजन	206.2808
InChI	InChI=1/C13H18O2/c14-13(15)11-7-2-1-4-8-12-9-5-3-6-10-12/h3,5-6,9-10H,1-2,4,7-8,11H2,(H,14,15)
कैस रजिस्टी संख्या	40228-90-8
आणविक संरचना
घनत्व	1.034g/cm³
उबलने का समय	356.5°C at 760 mmHg
अपवर्तक सूचकांक	1.519
फ्लैश प्वाइंट	253.5°C
खतरे के कोड	R36/38:Irritating to eyes and skin.;
सुरक्षा विवरण	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;